C31H35ClO5 — CID 77386917
[6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4-phenylmethoxyoxan-2-yl]methanol (PubChem CID 77386917) has the molecular formula C31H35ClO5 and a molecular weight of 523.07 g/mol. Its IUPAC name is [6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 77386917 |
| Molecular Formula | C31H35ClO5 |
| Molecular Weight | 523.07 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | [6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4-phenylmethoxyoxan-2-yl]methanol |
| SMILES | OCC1CC(OCc2ccccc2)CC(c2ccc(Cl)c(Cc3ccc(OCCOC4CC4)cc3)c2)O1 |
| InChI | InChI=1S/C31H35ClO5/c32-30-13-8-24(31-19-28(18-29(20-33)37-31)36-21-23-4-2-1-3-5-23)17-25(30)16-22-6-9-26(10-7-22)34-14-15-35-27-11-12-27/h1-10,13,17,27-29,31,33H,11-12,14-16,18-21H2 |
| InChIKey | XGTOUNICVHJZCI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.07 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|