C32H37ClO5 — CID 88556203
(2S,4R,6R)-6-[3-[[4-(2-butan-2-yloxyethoxy)phenyl]methyl]-4-chlorophenyl]-4-phenylmethoxyoxane-2-carbaldehyde (PubChem CID 88556203) has the molecular formula C32H37ClO5 and a molecular weight of 537.10 g/mol. Its IUPAC name is (2S,4R,6R)-6-[3-[[4-(2-butan-2-yloxyethoxy)phenyl]methyl]-4-chlorophenyl]-4-phenylmethoxyoxane-2-carbaldehyde.
| Compound Name | (2S,4R,6R)-6-[3-[[4-(2-butan-2-yloxyethoxy)phenyl]methyl]-4-chlorophenyl]-4-phenylmethoxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 88556203 |
| Molecular Formula | C32H37ClO5 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | (2S,4R,6R)-6-[3-[[4-(2-butan-2-yloxyethoxy)phenyl]methyl]-4-chlorophenyl]-4-phenylmethoxyoxane-2-carbaldehyde |
| SMILES | CCC(C)OCCOc1ccc(Cc2cc([C@H]3C[C@@H](OCc4ccccc4)C[C@@H](C=O)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C32H37ClO5/c1-3-23(2)35-15-16-36-28-12-9-24(10-13-28)17-27-18-26(11-14-31(27)33)32-20-29(19-30(21-34)38-32)37-22-25-7-5-4-6-8-25/h4-14,18,21,23,29-30,32H,3,15-17,19-20,22H2,1-2H3/t23?,29-,30-,32+/m0/s1 |
| InChIKey | WWJHDGLJKAMUGO-DESAWHRXSA-N |
| XLogP | 7.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|