C35H35ClO5 — CID 144747134
(8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-7,8-bis(phenylmethoxy)-1,4-dioxaspiro[2.5]octane (PubChem CID 144747134) has the molecular formula C35H35ClO5 and a molecular weight of 571.11 g/mol. Its IUPAC name is (8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-7,8-bis(phenylmethoxy)-1,4-dioxaspiro[2.5]octane.
| Compound Name | (8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-7,8-bis(phenylmethoxy)-1,4-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 144747134 |
| Molecular Formula | C35H35ClO5 |
| Molecular Weight | 571.11 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-7,8-bis(phenylmethoxy)-1,4-dioxaspiro[2.5]octane |
| SMILES | CCOc1ccc(Cc2cc(C3CC(OCc4ccccc4)[C@H](OCc4ccccc4)C4(CO4)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C35H35ClO5/c1-2-37-30-16-13-25(14-17-30)19-29-20-28(15-18-31(29)36)32-21-33(38-22-26-9-5-3-6-10-26)34(35(41-32)24-40-35)39-23-27-11-7-4-8-12-27/h3-18,20,32-34H,2,19,21-24H2,1H3/t32?,33?,34-,35?/m0/s1 |
| InChIKey | APNIEYZYFSEPJM-URPJYLLXSA-N |
| XLogP | 7.69 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.11 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|