C37H39ClO5 — CID 141431951
(1R,3S,4R,5S,6R)-3-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-methoxy-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.2.0]octane (PubChem CID 141431951) has the molecular formula C37H39ClO5 and a molecular weight of 599.17 g/mol. Its IUPAC name is (1R,3S,4R,5S,6R)-3-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-methoxy-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.2.0]octane.
| Compound Name | (1R,3S,4R,5S,6R)-3-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-methoxy-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 141431951 |
| Molecular Formula | C37H39ClO5 |
| Molecular Weight | 599.17 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | (1R,3S,4R,5S,6R)-3-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-methoxy-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.2.0]octane |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@]4(OC)CC[C@@H]4[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C37H39ClO5/c1-3-40-31-17-14-26(15-18-31)22-30-23-29(16-19-33(30)38)34-36(42-25-28-12-8-5-9-13-28)35(32-20-21-37(32,39-2)43-34)41-24-27-10-6-4-7-11-27/h4-19,23,32,34-36H,3,20-22,24-25H2,1-2H3/t32-,34+,35+,36+,37-/m1/s1 |
| InChIKey | YFBXIOLVRHBDIF-VOLCAMQRSA-N |
| XLogP | 8.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.17 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |