C25H31ClF2O6 — CID 144747158
2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(difluoromethoxy)oxan-4-ol;methanol (PubChem CID 144747158) has the molecular formula C25H31ClF2O6 and a molecular weight of 500.97 g/mol. Its IUPAC name is 2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(difluoromethoxy)oxan-4-ol;methanol.
| Compound Name | 2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(difluoromethoxy)oxan-4-ol;methanol |
|---|---|
| PubChem CID | 144747158 |
| Molecular Formula | C25H31ClF2O6 |
| Molecular Weight | 500.97 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(difluoromethoxy)oxan-4-ol;methanol |
| SMILES | CO.OC1CC(OC(F)F)OC(c2ccc(Cl)c(Cc3ccc(OCCOC4CC4)cc3)c2)C1 |
| InChI | InChI=1S/C24H27ClF2O5.CH4O/c25-21-8-3-16(22-13-18(28)14-23(31-22)32-24(26)27)12-17(21)11-15-1-4-19(5-2-15)29-9-10-30-20-6-7-20;1-2/h1-5,8,12,18,20,22-24,28H,6-7,9-11,13-14H2;2H,1H3 |
| InChIKey | FGUBDNCGCWHLRK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.97 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|