C44H49ClO10 — CID 123425570
[2,6-diacetyloxy-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4,5-bis(phenylmethoxy)hexyl] acetate (PubChem CID 123425570) has the molecular formula C44H49ClO10 and a molecular weight of 773.32 g/mol. Its IUPAC name is [2,6-diacetyloxy-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4,5-bis(phenylmethoxy)hexyl] acetate.
| Compound Name | [2,6-diacetyloxy-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4,5-bis(phenylmethoxy)hexyl] acetate |
|---|---|
| PubChem CID | 123425570 |
| Molecular Formula | C44H49ClO10 |
| Molecular Weight | 773.32 g/mol |
| Exact Mass | 772.30 |
| IUPAC Name | [2,6-diacetyloxy-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-4,5-bis(phenylmethoxy)hexyl] acetate |
| SMILES | CC(=O)OCC(CC(OCc1ccccc1)C(OCc1ccccc1)C(OC(C)=O)c1ccc(Cl)c(Cc2ccc(OCCOC3CC3)cc2)c1)OC(C)=O |
| InChI | InChI=1S/C44H49ClO10/c1-30(46)51-29-40(54-31(2)47)26-42(52-27-34-10-6-4-7-11-34)44(53-28-35-12-8-5-9-13-35)43(55-32(3)48)36-16-21-41(45)37(25-36)24-33-14-17-38(18-15-33)49-22-23-50-39-19-20-39/h4-18,21,25,39-40,42-44H,19-20,22-24,26-29H2,1-3H3 |
| InChIKey | JLWIYLYIMZQQDQ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.32 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|