C42H41ClO7 — CID 175306498
(2R,3S,4S)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxy-2,3,4-tris(phenylmethoxy)hexane-1,5-dione (PubChem CID 175306498) has the molecular formula C42H41ClO7 and a molecular weight of 693.24 g/mol. Its IUPAC name is (2R,3S,4S)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxy-2,3,4-tris(phenylmethoxy)hexane-1,5-dione.
| Compound Name | (2R,3S,4S)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxy-2,3,4-tris(phenylmethoxy)hexane-1,5-dione |
|---|---|
| PubChem CID | 175306498 |
| Molecular Formula | C42H41ClO7 |
| Molecular Weight | 693.24 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | (2R,3S,4S)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxy-2,3,4-tris(phenylmethoxy)hexane-1,5-dione |
| SMILES | CCOc1ccc(Cc2cc(C(=O)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)C(=O)CO)ccc2Cl)cc1 |
| InChI | InChI=1S/C42H41ClO7/c1-2-47-36-21-18-30(19-22-36)24-35-25-34(20-23-37(35)43)39(46)41(49-28-32-14-8-4-9-15-32)42(50-29-33-16-10-5-11-17-33)40(38(45)26-44)48-27-31-12-6-3-7-13-31/h3-23,25,40-42,44H,2,24,26-29H2,1H3/t40-,41+,42-/m1/s1 |
| InChIKey | XLZHBPKVJSHADZ-BMBFPDSCSA-N |
| XLogP | 7.83 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.24 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |