C21H25ClO7 — CID 126673820
(2R,3S,4R,5R)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4,5,6-pentahydroxyhexan-1-one (PubChem CID 126673820) has the molecular formula C21H25ClO7 and a molecular weight of 424.88 g/mol. Its IUPAC name is (2R,3S,4R,5R)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4,5,6-pentahydroxyhexan-1-one.
| Compound Name | (2R,3S,4R,5R)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4,5,6-pentahydroxyhexan-1-one |
|---|---|
| PubChem CID | 126673820 |
| Molecular Formula | C21H25ClO7 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (2R,3S,4R,5R)-1-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4,5,6-pentahydroxyhexan-1-one |
| SMILES | CCOc1ccc(Cc2cc(C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClO7/c1-2-29-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)18(25)20(27)21(28)19(26)17(24)11-23/h3-8,10,17,19-21,23-24,26-28H,2,9,11H2,1H3/t17-,19-,20+,21+/m1/s1 |
| InChIKey | MHCCOYDGAGOVAQ-PBASOCQRSA-N |
| XLogP | 0.95 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |