C49H51ClO7 — CID 141194981
(2R,3R,4S,5S)-6-[4-chloro-3-[[4-(2-hydroxyethyl)phenyl]methyl]phenyl]-3,4,5,6-tetrakis(phenylmethoxy)hexane-1,2-diol (PubChem CID 141194981) has the molecular formula C49H51ClO7 and a molecular weight of 787.39 g/mol. Its IUPAC name is (2R,3R,4S,5S)-6-[4-chloro-3-[[4-(2-hydroxyethyl)phenyl]methyl]phenyl]-3,4,5,6-tetrakis(phenylmethoxy)hexane-1,2-diol.
| Compound Name | (2R,3R,4S,5S)-6-[4-chloro-3-[[4-(2-hydroxyethyl)phenyl]methyl]phenyl]-3,4,5,6-tetrakis(phenylmethoxy)hexane-1,2-diol |
|---|---|
| PubChem CID | 141194981 |
| Molecular Formula | C49H51ClO7 |
| Molecular Weight | 787.39 g/mol |
| Exact Mass | 786.33 |
| IUPAC Name | (2R,3R,4S,5S)-6-[4-chloro-3-[[4-(2-hydroxyethyl)phenyl]methyl]phenyl]-3,4,5,6-tetrakis(phenylmethoxy)hexane-1,2-diol |
| SMILES | OCCc1ccc(Cc2cc(C(OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](O)CO)ccc2Cl)cc1 |
| InChI | InChI=1S/C49H51ClO7/c50-44-26-25-42(30-43(44)29-37-23-21-36(22-24-37)27-28-51)46(54-32-38-13-5-1-6-14-38)48(56-34-40-17-9-3-10-18-40)49(57-35-41-19-11-4-12-20-41)47(45(53)31-52)55-33-39-15-7-2-8-16-39/h1-26,30,45-49,51-53H,27-29,31-35H2/t45-,46?,47-,48+,49+/m1/s1 |
| InChIKey | ZXPOPONSPBZGKO-GGOWYIEVSA-N |
| XLogP | 8.83 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.39 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |