C16H26O6S2 — CID 69403057
(2R,3S,4R)-5,5-bis(ethylsulfanyloxy)-3-phenylmethoxypentane-1,2,4-triol (PubChem CID 69403057) has the molecular formula C16H26O6S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is (2R,3S,4R)-5,5-bis(ethylsulfanyloxy)-3-phenylmethoxypentane-1,2,4-triol.
| Compound Name | (2R,3S,4R)-5,5-bis(ethylsulfanyloxy)-3-phenylmethoxypentane-1,2,4-triol |
|---|---|
| PubChem CID | 69403057 |
| Molecular Formula | C16H26O6S2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2R,3S,4R)-5,5-bis(ethylsulfanyloxy)-3-phenylmethoxypentane-1,2,4-triol |
| SMILES | CCSOC(OSCC)[C@H](O)[C@@H](OCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C16H26O6S2/c1-3-23-21-16(22-24-4-2)14(19)15(13(18)10-17)20-11-12-8-6-5-7-9-12/h5-9,13-19H,3-4,10-11H2,1-2H3/t13-,14-,15+/m1/s1 |
| InChIKey | DMAVAOXEZPQSDX-KFWWJZLASA-N |
| XLogP | 1.98 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|