C24H35O9P — CID 70348497
diethyl [(2S,3R,4R,5R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)hexyl] phosphate (PubChem CID 70348497) has the molecular formula C24H35O9P and a molecular weight of 498.51 g/mol. Its IUPAC name is diethyl [(2S,3R,4R,5R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)hexyl] phosphate.
| Compound Name | diethyl [(2S,3R,4R,5R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)hexyl] phosphate |
|---|---|
| PubChem CID | 70348497 |
| Molecular Formula | C24H35O9P |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | diethyl [(2S,3R,4R,5R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)hexyl] phosphate |
| SMILES | CCOP(=O)(OCC)OC[C@H](O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C24H35O9P/c1-3-31-34(28,32-4-2)33-18-22(27)24(30-17-20-13-9-6-10-14-20)23(21(26)15-25)29-16-19-11-7-5-8-12-19/h5-14,21-27H,3-4,15-18H2,1-2H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | QCDKTHJZEXPPHD-UEQSERJNSA-N |
| XLogP | 3.07 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|