C28H29ClO6 — CID 126552895
(2R,3S,4R,6R)-6-[4-chloro-3-[[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 126552895) has the molecular formula C28H29ClO6 and a molecular weight of 496.99 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-[4-chloro-3-[[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,6R)-6-[4-chloro-3-[[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 126552895 |
| Molecular Formula | C28H29ClO6 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (2R,3S,4R,6R)-6-[4-chloro-3-[[4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OCC4Cc5ccccc5O4)cc3)c2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H29ClO6/c29-23-10-7-19(26-14-24(31)28(32)27(15-30)35-26)12-20(23)11-17-5-8-21(9-6-17)33-16-22-13-18-3-1-2-4-25(18)34-22/h1-10,12,22,24,26-28,30-32H,11,13-16H2/t22?,24-,26-,27-,28+/m1/s1 |
| InChIKey | WJLHWYVCMAHCIL-QJXKSEBGSA-N |
| XLogP | 3.86 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |