C24H24ClNO7 — CID 140509300
(2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyridin-3-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 140509300) has the molecular formula C24H24ClNO7 and a molecular weight of 473.91 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyridin-3-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyridin-3-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140509300 |
| Molecular Formula | C24H24ClNO7 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyridin-3-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@](O)(c2ccc(Cl)c(Cc3ccc(Oc4cccnc4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H24ClNO7/c25-19-8-5-16(24(31)23(30)22(29)21(28)20(13-27)33-24)11-15(19)10-14-3-6-17(7-4-14)32-18-2-1-9-26-12-18/h1-9,11-12,20-23,27-31H,10,13H2/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | LOXLPRRPUQCGLI-GNADVCDUSA-N |
| XLogP | 1.74 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |