C24H29ClO9 — CID 141370016
[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-methoxyacetate (PubChem CID 141370016) has the molecular formula C24H29ClO9 and a molecular weight of 496.94 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-methoxyacetate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 141370016 |
| Molecular Formula | C24H29ClO9 |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-methoxyacetate |
| SMILES | CCOc1ccc(Cc2cc([C@@]3(O)O[C@H](COC(=O)COC)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H29ClO9/c1-3-32-17-7-4-14(5-8-17)10-15-11-16(6-9-18(15)25)24(30)23(29)22(28)21(27)19(34-24)12-33-20(26)13-31-2/h4-9,11,19,21-23,27-30H,3,10,12-13H2,1-2H3/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | YWBNYEANODSPDQ-PFKOEMKTSA-N |
| XLogP | 1.15 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |