C23H27NO6 — CID 154632669
(5R,6S,7S)-5-(hydroxymethyl)-3a-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol (PubChem CID 154632669) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (5R,6S,7S)-5-(hydroxymethyl)-3a-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol.
| Compound Name | (5R,6S,7S)-5-(hydroxymethyl)-3a-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
|---|---|
| PubChem CID | 154632669 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (5R,6S,7S)-5-(hydroxymethyl)-3a-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
| SMILES | COc1ccc(Cc2cc(C34N=C(C)OC3[C@@H](O)[C@H](O)[C@@H](CO)O4)ccc2C)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-13-4-7-17(11-16(13)10-15-5-8-18(28-3)9-6-15)23-22(29-14(2)24-23)21(27)20(26)19(12-25)30-23/h4-9,11,19-22,25-27H,10,12H2,1-3H3/t19-,20-,21+,22?,23?/m1/s1 |
| InChIKey | VMASLIDGSDMLKL-OKXYMDNISA-N |
| XLogP | 1.68 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |