C20H21ClO5 — CID 163727935
1-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3-methyl-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol (PubChem CID 163727935) has the molecular formula C20H21ClO5 and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3-methyl-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol.
| Compound Name | 1-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3-methyl-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
|---|---|
| PubChem CID | 163727935 |
| Molecular Formula | C20H21ClO5 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3-methyl-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
| SMILES | COc1ccc(Cc2cc(C34OC(C)C(O)C(O)C3O4)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H21ClO5/c1-11-17(22)18(23)19-20(25-11,26-19)14-5-8-16(21)13(10-14)9-12-3-6-15(24-2)7-4-12/h3-8,10-11,17-19,22-23H,9H2,1-2H3 |
| InChIKey | KXECMSGBHUHGHJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|