C25H35ClO6 — CID 142285564
2-[4-chloro-3-[ethoxy-(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethanol (PubChem CID 142285564) has the molecular formula C25H35ClO6 and a molecular weight of 467.00 g/mol. Its IUPAC name is 2-[4-chloro-3-[ethoxy-(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethanol.
| Compound Name | 2-[4-chloro-3-[ethoxy-(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethanol |
|---|---|
| PubChem CID | 142285564 |
| Molecular Formula | C25H35ClO6 |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[4-chloro-3-[ethoxy-(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethanol |
| SMILES | CCO.CCOc1ccc(C(OCC)c2cc(C3CC(O)CC(CO)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H29ClO5.C2H6O/c1-3-27-18-8-5-15(6-9-18)23(28-4-2)20-11-16(7-10-21(20)24)22-13-17(26)12-19(14-25)29-22;1-2-3/h5-11,17,19,22-23,25-26H,3-4,12-14H2,1-2H3;3H,2H2,1H3 |
| InChIKey | QXHTWWMVRMWEDA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |