About 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol
2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143172081) has the molecular formula C18H25ClO5
and a molecular weight of 356.85 g/mol. Its IUPAC name is 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol.
Molecular Properties
| Compound Name | 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol |
| PubChem CID | 143172081 |
| Molecular Formula | C18H25ClO5 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CO[C@@H]1CC[C@H](Oc2cc(C3CC(O)CC(CO)O3)ccc2Cl)C1 |
| InChI | InChI=1S/C18H25ClO5/c1-22-13-3-4-14(9-13)23-18-6-11(2-5-16(18)19)17-8-12(21)7-15(10-20)24-17/h2,5-6,12-15,17,20-21H,3-4,7-10H2,1H3/t12?,13-,14+,15?,17?/m1/s1 |
| InChIKey | GLNSJMFYQBLLPK-APMDICNKSA-N |
| XLogP | 2.86 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol?
The IUPAC name of 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol (CID 143172081) is 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol.
What is the SMILES notation for 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol?
The canonical SMILES for 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol is CO[C@@H]1CC[C@H](Oc2cc(C3CC(O)CC(CO)O3)ccc2Cl)C1.
What is the InChIKey of 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol?
The InChIKey is GLNSJMFYQBLLPK-APMDICNKSA-N. The full InChI is InChI=1S/C18H25ClO5/c1-22-13-3-4-14(9-13)23-18-6-11(2-5-16(18)19)17-8-12(21)7-15(10-20)24-17/h2,5-6,12-15,17,20-21H,3-4,7-10H2,1H3/t12?,13-,14+,15?,17?/m1/s1.
What are the key properties of 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol?
2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol has a molecular weight of 356.85 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxan-4-ol is sourced from PubChem (CID 143172081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).