C26H34ClNO8 — CID 134256543
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 134256543) has the molecular formula C26H34ClNO8 and a molecular weight of 524.01 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 134256543 |
| Molecular Formula | C26H34ClNO8 |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | CCOc1ccc(C(c2cc([C@]3(OC)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H34ClNO8/c1-3-35-18-7-4-16(5-8-18)22(28-10-12-34-13-11-28)19-14-17(6-9-20(19)27)26(33-2)25(32)24(31)23(30)21(15-29)36-26/h4-9,14,21-25,29-32H,3,10-13,15H2,1-2H3/t21-,22?,23-,24+,25-,26+/m1/s1 |
| InChIKey | VFFAXQOUJACWLM-WDZLRSDGSA-N |
| XLogP | 1.43 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |