C35H58ClNO7Si3 — CID 159571318
(2S,3R,4S,5R,6S)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-5-methyl-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol (PubChem CID 159571318) has the molecular formula C35H58ClNO7Si3 and a molecular weight of 724.56 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-5-methyl-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6S)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-5-methyl-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 159571318 |
| Molecular Formula | C35H58ClNO7Si3 |
| Molecular Weight | 724.56 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | (2S,3R,4S,5R,6S)-2-[4-chloro-3-[(4-ethoxyphenyl)-morpholin-4-ylmethyl]phenyl]-5-methyl-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol |
| SMILES | CCOc1ccc(C(c2cc([C@]3(O)O[C@H](CO[Si](C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)ccc2Cl)N2CCOCC2)cc1 |
| InChI | InChI=1S/C35H58ClNO7Si3/c1-12-40-28-16-13-26(14-17-28)32(37-19-21-39-22-20-37)29-23-27(15-18-30(29)36)35(38)34(44-47(9,10)11)33(43-46(6,7)8)25(2)31(42-35)24-41-45(3,4)5/h13-18,23,25,31-34,38H,12,19-22,24H2,1-11H3/t25-,31-,32?,33+,34-,35+/m1/s1 |
| InChIKey | RCFYSJBAMKPUSM-KBSWZPCMSA-N |
| XLogP | 7.63 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.56 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|