C31H43ClO4Si — CID 157281223
(3R,4S,5S,6R)-2-[3-[[4-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]-4-chlorophenyl]-6-ethyl-4,5-dimethyl-3-trimethylsilyloxyoxan-2-ol (PubChem CID 157281223) has the molecular formula C31H43ClO4Si and a molecular weight of 543.22 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[3-[[4-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]-4-chlorophenyl]-6-ethyl-4,5-dimethyl-3-trimethylsilyloxyoxan-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[3-[[4-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]-4-chlorophenyl]-6-ethyl-4,5-dimethyl-3-trimethylsilyloxyoxan-2-ol |
|---|---|
| PubChem CID | 157281223 |
| Molecular Formula | C31H43ClO4Si |
| Molecular Weight | 543.22 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (3R,4S,5S,6R)-2-[3-[[4-[[(1S,5R)-3-bicyclo[3.1.0]hexanyl]oxy]phenyl]methyl]-4-chlorophenyl]-6-ethyl-4,5-dimethyl-3-trimethylsilyloxyoxan-2-ol |
| SMILES | CC[C@H]1OC(O)(c2ccc(Cl)c(Cc3ccc(OC4C[C@@H]5C[C@@H]5C4)cc3)c2)[C@H](O[Si](C)(C)C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C31H43ClO4Si/c1-7-29-19(2)20(3)30(36-37(4,5)6)31(33,35-29)25-10-13-28(32)24(16-25)14-21-8-11-26(12-9-21)34-27-17-22-15-23(22)18-27/h8-13,16,19-20,22-23,27,29-30,33H,7,14-15,17-18H2,1-6H3/t19-,20-,22-,23+,27?,29+,30+,31?/m0/s1 |
| InChIKey | WKSVRTKBTNOVJO-DTTMDAQZSA-N |
| XLogP | 7.55 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.22 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|