C29H47ClO4Si3 — CID 58343628
(3R,4S,5S,6R)-2-[4-chloro-3-[(4-methylphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol (PubChem CID 58343628) has the molecular formula C29H47ClO4Si3 and a molecular weight of 579.40 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[(4-methylphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-methylphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol |
|---|---|
| PubChem CID | 58343628 |
| Molecular Formula | C29H47ClO4Si3 |
| Molecular Weight | 579.40 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-methylphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol |
| SMILES | Cc1ccc(Cc2cc(C3(O)O[C@H]([Si](C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H47ClO4Si3/c1-20-12-14-22(15-13-20)18-23-19-24(16-17-25(23)30)29(31)27(34-37(9,10)11)26(33-36(6,7)8)21(2)28(32-29)35(3,4)5/h12-17,19,21,26-28,31H,18H2,1-11H3/t21-,26-,27+,28+,29?/m0/s1 |
| InChIKey | MCGZZHZTGHTOLI-VSCCJPJYSA-N |
| XLogP | 7.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.40 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|