C57H59FO7Si — CID 87848545
(2S,3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 87848545) has the molecular formula C57H59FO7Si and a molecular weight of 903.18 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 87848545 |
| Molecular Formula | C57H59FO7Si |
| Molecular Weight | 903.18 g/mol |
| Exact Mass | 902.40 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | CC(C)(C)[Si](OCc1cc(F)cc([C@]2(O)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C57H59FO7Si/c1-56(2,3)66(50-30-18-8-19-31-50,51-32-20-9-21-33-51)64-41-47-34-48(36-49(58)35-47)57(59)55(63-40-46-28-16-7-17-29-46)54(62-39-45-26-14-6-15-27-45)53(61-38-44-24-12-5-13-25-44)52(65-57)42-60-37-43-22-10-4-11-23-43/h4-36,52-55,59H,37-42H2,1-3H3/t52-,53-,54+,55-,57+/m1/s1 |
| InChIKey | WYHWEHLSDIHPQD-MHLSNBFHSA-N |
| XLogP | 10.42 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.18 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|