C49H58ClFO7Si — CID 123271737
tert-butyl-[[6-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane (PubChem CID 123271737) has the molecular formula C49H58ClFO7Si and a molecular weight of 841.53 g/mol. Its IUPAC name is tert-butyl-[[6-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123271737 |
| Molecular Formula | C49H58ClFO7Si |
| Molecular Weight | 841.53 g/mol |
| Exact Mass | 840.36 |
| IUPAC Name | tert-butyl-[[6-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane |
| SMILES | CCOc1ccc(Cc2cc(C3OC(CO[Si](C)(C)C(C)(C)C)C(OCc4ccccc4)C(OCc4ccccc4)C3(OC)OCc3ccccc3)ccc2Cl)cc1F |
| InChI | InChI=1S/C49H58ClFO7Si/c1-8-53-43-27-24-38(29-42(43)51)28-40-30-39(25-26-41(40)50)46-49(52-5,56-33-37-22-16-11-17-23-37)47(55-32-36-20-14-10-15-21-36)45(54-31-35-18-12-9-13-19-35)44(58-46)34-57-59(6,7)48(2,3)4/h9-27,29-30,44-47H,8,28,31-34H2,1-7H3 |
| InChIKey | CHGQQXCVEBOZNM-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.53 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|