C21H24BrClO9 — CID 163730699
[(1R,2S,3S,4R,5S)-3,4-diacetyloxy-5-[3-(bromomethyl)-4-chlorophenyl]-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate (PubChem CID 163730699) has the molecular formula C21H24BrClO9 and a molecular weight of 535.77 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5S)-3,4-diacetyloxy-5-[3-(bromomethyl)-4-chlorophenyl]-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate.
| Compound Name | [(1R,2S,3S,4R,5S)-3,4-diacetyloxy-5-[3-(bromomethyl)-4-chlorophenyl]-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 163730699 |
| Molecular Formula | C21H24BrClO9 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | [(1R,2S,3S,4R,5S)-3,4-diacetyloxy-5-[3-(bromomethyl)-4-chlorophenyl]-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate |
| SMILES | CO[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@]2(c3ccc(Cl)c(CBr)c3)OC[C@]1(COC(C)=O)O2 |
| InChI | InChI=1S/C21H24BrClO9/c1-11(24)28-9-20-10-29-21(32-20,15-5-6-16(23)14(7-15)8-22)19(31-13(3)26)17(18(20)27-4)30-12(2)25/h5-7,17-19H,8-10H2,1-4H3/t17-,18-,19+,20-,21-/m0/s1 |
| InChIKey | KZHJPMAGFFOYGS-WHZJULEDSA-N |
| XLogP | 2.63 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|