C22H25ClO6 — CID 144812919
(1R,3S,4R,5S)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-1-(2-hydroxypropan-2-yl)-6,8-dioxabicyclo[3.2.1]octane-3,4-diol (PubChem CID 144812919) has the molecular formula C22H25ClO6 and a molecular weight of 420.89 g/mol. Its IUPAC name is (1R,3S,4R,5S)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-1-(2-hydroxypropan-2-yl)-6,8-dioxabicyclo[3.2.1]octane-3,4-diol.
| Compound Name | (1R,3S,4R,5S)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-1-(2-hydroxypropan-2-yl)-6,8-dioxabicyclo[3.2.1]octane-3,4-diol |
|---|---|
| PubChem CID | 144812919 |
| Molecular Formula | C22H25ClO6 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (1R,3S,4R,5S)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-1-(2-hydroxypropan-2-yl)-6,8-dioxabicyclo[3.2.1]octane-3,4-diol |
| SMILES | CC(C)(O)[C@@]12CO[C@@](c3ccc(Cl)c(Cc4ccc(O)cc4)c3)(O1)[C@H](O)[C@@H](O)C2 |
| InChI | InChI=1S/C22H25ClO6/c1-20(2,27)21-11-18(25)19(26)22(29-21,28-12-21)15-5-8-17(23)14(10-15)9-13-3-6-16(24)7-4-13/h3-8,10,18-19,24-27H,9,11-12H2,1-2H3/t18-,19+,21+,22-/m0/s1 |
| InChIKey | WRRBXMLOBDJFFW-PSBKLILYSA-N |
| XLogP | 2.47 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |