C43H39ClF2O7 — CID 118377862
(1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde (PubChem CID 118377862) has the molecular formula C43H39ClF2O7 and a molecular weight of 741.23 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde.
| Compound Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde |
|---|---|
| PubChem CID | 118377862 |
| Molecular Formula | C43H39ClF2O7 |
| Molecular Weight | 741.23 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carbaldehyde |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@](C=O)(O3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]4OCc3ccccc3)ccc2Cl)c(F)c1F |
| InChI | InChI=1S/C43H39ClF2O7/c1-2-48-36-21-18-32(37(45)38(36)46)22-33-23-34(19-20-35(33)44)43-41(51-26-31-16-10-5-11-17-31)39(49-24-29-12-6-3-7-13-29)40(42(27-47,53-43)28-52-43)50-25-30-14-8-4-9-15-30/h3-21,23,27,39-41H,2,22,24-26,28H2,1H3/t39-,40-,41+,42-,43-/m0/s1 |
| InChIKey | JHVNOMPCASTGRR-AQOUKQHESA-N |
| XLogP | 8.51 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.23 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|