C34H45ClF2O8 — CID 118396465
(1S,2S,3S,4R,5S)-2,3,4-tributoxy-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid (PubChem CID 118396465) has the molecular formula C34H45ClF2O8 and a molecular weight of 655.18 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-2,3,4-tributoxy-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R,5S)-2,3,4-tributoxy-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 118396465 |
| Molecular Formula | C34H45ClF2O8 |
| Molecular Weight | 655.18 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | (1S,2S,3S,4R,5S)-2,3,4-tributoxy-5-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@@]2(c3ccc(Cl)c(Cc4ccc(OCC)c(F)c4F)c3)OC[C@](C(=O)O)(O2)[C@H]1OCCCC |
| InChI | InChI=1S/C34H45ClF2O8/c1-5-9-16-41-29-30(42-17-10-6-2)33(32(38)39)21-44-34(45-33,31(29)43-18-11-7-3)24-13-14-25(35)23(20-24)19-22-12-15-26(40-8-4)28(37)27(22)36/h12-15,20,29-31H,5-11,16-19,21H2,1-4H3,(H,38,39)/t29-,30-,31+,33-,34-/m0/s1 |
| InChIKey | WINOKCMCAIOHCV-AJGKOHEOSA-N |
| XLogP | 7.20 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.18 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|