C18H23ClO7 — CID 69197918
(2S,3R,4S,5S,6R)-2-[4-chloro-3-(oxan-4-ylidenemethyl)phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 69197918) has the molecular formula C18H23ClO7 and a molecular weight of 386.83 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-(oxan-4-ylidenemethyl)phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-(oxan-4-ylidenemethyl)phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69197918 |
| Molecular Formula | C18H23ClO7 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-(oxan-4-ylidenemethyl)phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@](O)(c2ccc(Cl)c(C=C3CCOCC3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H23ClO7/c19-13-2-1-12(8-11(13)7-10-3-5-25-6-4-10)18(24)17(23)16(22)15(21)14(9-20)26-18/h1-2,7-8,14-17,20-24H,3-6,9H2/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | FCSDOWFACCUCTE-SFFUCWETSA-N |
| XLogP | 0.15 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |