C23H29ClO6 — CID 69196244
(2S,3R,4S,5S,6R)-2-[3-(2-adamantylidenemethyl)-4-chlorophenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 69196244) has the molecular formula C23H29ClO6 and a molecular weight of 436.93 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-(2-adamantylidenemethyl)-4-chlorophenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-(2-adamantylidenemethyl)-4-chlorophenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69196244 |
| Molecular Formula | C23H29ClO6 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-(2-adamantylidenemethyl)-4-chlorophenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@](O)(c2ccc(Cl)c(C=C3C4CC5CC(C4)CC3C5)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H29ClO6/c24-18-2-1-16(23(29)22(28)21(27)20(26)19(10-25)30-23)8-15(18)9-17-13-4-11-3-12(6-13)7-14(17)5-11/h1-2,8-9,11-14,19-22,25-29H,3-7,10H2/b17-9-/t11?,12?,13?,14?,19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | AUIOJBNFUZQWDI-MAXKINBKSA-N |
| XLogP | 1.80 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |