C21H31ClO8S — CID 11511308
(2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-ethoxycyclohexyl)oxyphenyl]-6-(methylsulfonylmethyl)oxane-3,4,5-triol (PubChem CID 11511308) has the molecular formula C21H31ClO8S and a molecular weight of 478.99 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-ethoxycyclohexyl)oxyphenyl]-6-(methylsulfonylmethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-ethoxycyclohexyl)oxyphenyl]-6-(methylsulfonylmethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11511308 |
| Molecular Formula | C21H31ClO8S |
| Molecular Weight | 478.99 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-ethoxycyclohexyl)oxyphenyl]-6-(methylsulfonylmethyl)oxane-3,4,5-triol |
| SMILES | CCOC1CCC(Oc2cc([C@@H]3O[C@H](CS(C)(=O)=O)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)CC1 |
| InChI | InChI=1S/C21H31ClO8S/c1-3-28-13-5-7-14(8-6-13)29-16-10-12(4-9-15(16)22)21-20(25)19(24)18(23)17(30-21)11-31(2,26)27/h4,9-10,13-14,17-21,23-25H,3,5-8,11H2,1-2H3/t13?,14?,17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | BSGLITGTPHJPSP-DMDCGFLWSA-N |
| XLogP | 1.63 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.99 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |