C22H25BrO5 — CID 59267200
(2S,3R,4R,5S,6R)-2-[3-[(4-bromophenyl)methyl]-4-cyclopropylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59267200) has the molecular formula C22H25BrO5 and a molecular weight of 449.34 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-bromophenyl)methyl]-4-cyclopropylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-bromophenyl)methyl]-4-cyclopropylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59267200 |
| Molecular Formula | C22H25BrO5 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-bromophenyl)methyl]-4-cyclopropylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(C3CC3)c(Cc3ccc(Br)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H25BrO5/c23-16-6-1-12(2-7-16)9-15-10-14(5-8-17(15)13-3-4-13)22-21(27)20(26)19(25)18(11-24)28-22/h1-2,5-8,10,13,18-22,24-27H,3-4,9,11H2/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | HYHRYFYDGVHBFM-BDHVOXNPSA-N |
| XLogP | 2.43 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |