C28H25ClF2O7 — CID 118461929
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3-fluoro-4-[(6-fluoro-1-benzofuran-2-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 118461929) has the molecular formula C28H25ClF2O7 and a molecular weight of 546.95 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3-fluoro-4-[(6-fluoro-1-benzofuran-2-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3-fluoro-4-[(6-fluoro-1-benzofuran-2-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118461929 |
| Molecular Formula | C28H25ClF2O7 |
| Molecular Weight | 546.95 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3-fluoro-4-[(6-fluoro-1-benzofuran-2-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OCc4cc5ccc(F)cc5o4)c(F)c3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H25ClF2O7/c29-20-5-3-16(28-27(35)26(34)25(33)24(12-32)38-28)9-17(20)7-14-1-6-22(21(31)8-14)36-13-19-10-15-2-4-18(30)11-23(15)37-19/h1-6,8-11,24-28,32-35H,7,12-13H2/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | XTEHGZPRMAWKJY-DFLSAPQXSA-N |
| XLogP | 4.05 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |