C29H30ClFO7 — CID 118461905
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(5-fluoro-3-methyl-1,3-dihydro-2-benzofuran-1-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 118461905) has the molecular formula C29H30ClFO7 and a molecular weight of 545.00 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(5-fluoro-3-methyl-1,3-dihydro-2-benzofuran-1-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(5-fluoro-3-methyl-1,3-dihydro-2-benzofuran-1-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118461905 |
| Molecular Formula | C29H30ClFO7 |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(5-fluoro-3-methyl-1,3-dihydro-2-benzofuran-1-yl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1OC(COc2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C29H30ClFO7/c1-15-22-12-19(31)5-8-21(22)25(37-15)14-36-20-6-2-16(3-7-20)10-18-11-17(4-9-23(18)30)29-28(35)27(34)26(33)24(13-32)38-29/h2-9,11-12,15,24-29,32-35H,10,13-14H2,1H3/t15?,24-,25?,26-,27+,28-,29+/m1/s1 |
| InChIKey | AJZMWJYUTWAFTO-FGVLKKQASA-N |
| XLogP | 3.80 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |