C31H36ClNO7 — CID 158647949
(2S)-2-amino-3-phenylpropanoic acid;(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopropylphenyl)-dideuteriomethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 158647949) has the molecular formula C31H36ClNO7 and a molecular weight of 572.09 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopropylphenyl)-dideuteriomethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopropylphenyl)-dideuteriomethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 158647949 |
| Molecular Formula | C31H36ClNO7 |
| Molecular Weight | 572.09 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopropylphenyl)-dideuteriomethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.[2H]C([2H])(c1ccc(C2CC2)cc1)c1cc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1Cl |
| InChI | InChI=1S/C22H25ClO5.C9H11NO2/c23-17-8-7-15(22-21(27)20(26)19(25)18(11-24)28-22)10-16(17)9-12-1-3-13(4-2-12)14-5-6-14;10-8(9(11)12)6-7-4-2-1-3-5-7/h1-4,7-8,10,14,18-22,24-27H,5-6,9,11H2;1-5,8H,6,10H2,(H,11,12)/t18-,19-,20+,21-,22+;8-/m10/s1/i9D2; |
| InChIKey | IBEVPQFKVLLKSD-AQSXIFNBSA-N |
| XLogP | 2.96 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.09 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |