C42H49ClN2O11 — CID 46182065
bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46182065) has the molecular formula C42H49ClN2O11 and a molecular weight of 793.31 g/mol. Its IUPAC name is bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46182065 |
| Molecular Formula | C42H49ClN2O11 |
| Molecular Weight | 793.31 g/mol |
| Exact Mass | 792.30 |
| IUPAC Name | bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C#CCOCCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2Cl)cc1.N[C@@H](Cc1ccccc1)C(=O)O.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H27ClO7.2C9H11NO2/c1-2-9-30-10-11-31-18-6-3-15(4-7-18)12-17-13-16(5-8-19(17)25)24-23(29)22(28)21(27)20(14-26)32-24;2*10-8(9(11)12)6-7-4-2-1-3-5-7/h1,3-8,13,20-24,26-29H,9-12,14H2;2*1-5,8H,6,10H2,(H,11,12)/t20-,21-,22+,23?,24+;2*8-/m100/s1 |
| InChIKey | XFTRSTGNFVUYKB-CMQYWXPVSA-N |
| XLogP | 2.76 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|