C41H47ClN2O11 — CID 46182025
bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxybut-2-ynoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46182025) has the molecular formula C41H47ClN2O11 and a molecular weight of 779.28 g/mol. Its IUPAC name is bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxybut-2-ynoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxybut-2-ynoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46182025 |
| Molecular Formula | C41H47ClN2O11 |
| Molecular Weight | 779.28 g/mol |
| Exact Mass | 778.29 |
| IUPAC Name | bis((2S)-2-amino-3-phenylpropanoic acid);(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxybut-2-ynoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.N[C@@H](Cc1ccccc1)C(=O)O.OCC#CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClO7.2C9H11NO2/c24-18-8-5-15(23-22(29)21(28)20(27)19(13-26)31-23)12-16(18)11-14-3-6-17(7-4-14)30-10-2-1-9-25;2*10-8(9(11)12)6-7-4-2-1-3-5-7/h3-8,12,19-23,25-29H,9-11,13H2;2*1-5,8H,6,10H2,(H,11,12)/t19-,20-,21+,22-,23+;2*8-/m100/s1 |
| InChIKey | VUUHSVGLHJGZIS-VEAYBVQVSA-N |
| XLogP | 2.10 |
| TPSA | 246.25 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|