C21H22O6S — CID 90388145
(2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2,4-dihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 90388145) has the molecular formula C21H22O6S and a molecular weight of 402.47 g/mol. Its IUPAC name is (2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2,4-dihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2,4-dihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 90388145 |
| Molecular Formula | C21H22O6S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2,4-dihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@@H]1C[C@H](O)[C@@H](O)[C@H](c2cc(Cc3cc4ccccc4s3)c(O)cc2O)O1 |
| InChI | InChI=1S/C21H22O6S/c22-10-13-8-18(25)20(26)21(27-13)15-7-12(16(23)9-17(15)24)6-14-5-11-3-1-2-4-19(11)28-14/h1-5,7,9,13,18,20-26H,6,8,10H2/t13-,18-,20+,21-/m0/s1 |
| InChIKey | CZTKKPLQPLEBPK-OZOMQSQASA-N |
| XLogP | 2.45 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |