C22H22F2O6S — CID 146249897
(2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 146249897) has the molecular formula C22H22F2O6S and a molecular weight of 452.48 g/mol. Its IUPAC name is (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 146249897 |
| Molecular Formula | C22H22F2O6S |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | COc1cc(O)c([C@@H]2O[C@H](CO)C(F)(F)[C@H](O)[C@H]2O)cc1Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C22H22F2O6S/c1-29-16-9-15(26)14(20-19(27)21(28)22(23,24)18(10-25)30-20)8-12(16)7-13-6-11-4-2-3-5-17(11)31-13/h2-6,8-9,18-21,25-28H,7,10H2,1H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | GOCCTPLZCAJZLV-IVAOSVALSA-N |
| XLogP | 3.00 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |