C22H22F2O5S — CID 137498497
(2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5-fluoro-6-(fluoromethyl)oxane-3,4-diol (PubChem CID 137498497) has the molecular formula C22H22F2O5S and a molecular weight of 436.48 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5-fluoro-6-(fluoromethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5-fluoro-6-(fluoromethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 137498497 |
| Molecular Formula | C22H22F2O5S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl]-5-fluoro-6-(fluoromethyl)oxane-3,4-diol |
| SMILES | COc1cc(O)c([C@@H]2O[C@H](CF)[C@@H](F)[C@H](O)[C@H]2O)cc1Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C22H22F2O5S/c1-28-16-9-15(25)14(22-21(27)20(26)19(24)17(10-23)29-22)8-12(16)7-13-6-11-4-2-3-5-18(11)30-13/h2-6,8-9,17,19-22,25-27H,7,10H2,1H3/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | ZTEHQQGYMUCPGA-VOFPXKNKSA-N |
| XLogP | 3.68 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |