C42H49ClO6 — CID 90308364
[(1R,2S)-2-[[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]methyl]cyclopropyl]methanol (PubChem CID 90308364) has the molecular formula C42H49ClO6 and a molecular weight of 685.30 g/mol. Its IUPAC name is [(1R,2S)-2-[[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]methyl]cyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-[[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 90308364 |
| Molecular Formula | C42H49ClO6 |
| Molecular Weight | 685.30 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | [(1R,2S)-2-[[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]methyl]cyclopropyl]methanol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CC)[C@@H](C)[C@H](OCc4ccccc4)C3OCc3ccccc3)c(OC[C@H]3C[C@H]3CO)cc2Cl)cc1 |
| InChI | InChI=1S/C42H49ClO6/c1-4-38-28(3)40(47-25-30-12-8-6-9-13-30)42(48-26-31-14-10-7-11-15-31)41(49-38)36-22-32(20-29-16-18-35(19-17-29)45-5-2)37(43)23-39(36)46-27-34-21-33(34)24-44/h6-19,22-23,28,33-34,38,40-42,44H,4-5,20-21,24-27H2,1-3H3/t28-,33+,34-,38-,40+,41+,42?/m1/s1 |
| InChIKey | BPAWHLNGUQYOAK-CZLWTUGTSA-N |
| XLogP | 8.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.30 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |