C40H58ClIO8 — CID 89303672
[(2R,3R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-5-[(4-ethoxyphenyl)methyl]-2-[[(1R,2S)-2-(iodomethyl)cyclopropyl]methoxy]phenyl]oxan-2-yl]methyl acetate (PubChem CID 89303672) has the molecular formula C40H58ClIO8 and a molecular weight of 829.25 g/mol. Its IUPAC name is [(2R,3R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-5-[(4-ethoxyphenyl)methyl]-2-[[(1R,2S)-2-(iodomethyl)cyclopropyl]methoxy]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-5-[(4-ethoxyphenyl)methyl]-2-[[(1R,2S)-2-(iodomethyl)cyclopropyl]methoxy]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89303672 |
| Molecular Formula | C40H58ClIO8 |
| Molecular Weight | 829.25 g/mol |
| Exact Mass | 828.29 |
| IUPAC Name | [(2R,3R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-5-[(4-ethoxyphenyl)methyl]-2-[[(1R,2S)-2-(iodomethyl)cyclopropyl]methoxy]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CCCCOC1C(OCCCC)[C@H](OCCCC)[C@@H](COC(C)=O)O[C@H]1c1cc(Cc2ccc(OCC)cc2)c(Cl)cc1OC[C@@H]1C[C@@H]1CI |
| InChI | InChI=1S/C40H58ClIO8/c1-6-10-17-45-38-36(26-48-27(5)43)50-37(39(46-18-11-7-2)40(38)47-19-12-8-3)33-22-29(20-28-13-15-32(16-14-28)44-9-4)34(41)23-35(33)49-25-31-21-30(31)24-42/h13-16,22-23,30-31,36-40H,6-12,17-21,24-26H2,1-5H3/t30-,31+,36-,37+,38-,39?,40?/m1/s1 |
| InChIKey | YDDXYZIDICGFHT-VBZQOTMYSA-N |
| XLogP | 9.34 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.25 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|