C38H55ClO7 — CID 90309953
(1S,10R,12S,16R,17R,18R,19S)-17,18,19-tributoxy-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatetracyclo[14.3.1.02,7.010,12]icosa-2(7),3,5-triene (PubChem CID 90309953) has the molecular formula C38H55ClO7 and a molecular weight of 659.30 g/mol. Its IUPAC name is (1S,10R,12S,16R,17R,18R,19S)-17,18,19-tributoxy-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatetracyclo[14.3.1.02,7.010,12]icosa-2(7),3,5-triene.
| Compound Name | (1S,10R,12S,16R,17R,18R,19S)-17,18,19-tributoxy-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatetracyclo[14.3.1.02,7.010,12]icosa-2(7),3,5-triene |
|---|---|
| PubChem CID | 90309953 |
| Molecular Formula | C38H55ClO7 |
| Molecular Weight | 659.30 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | (1S,10R,12S,16R,17R,18R,19S)-17,18,19-tributoxy-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatetracyclo[14.3.1.02,7.010,12]icosa-2(7),3,5-triene |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@H]2O[C@H](COC[C@H]3C[C@H]3COc3cc(Cl)c(Cc4ccc(OCC)cc4)cc32)[C@H]1OCCCC |
| InChI | InChI=1S/C38H55ClO7/c1-5-9-16-42-36-34-25-40-23-28-20-29(28)24-45-33-22-32(39)27(19-26-12-14-30(15-13-26)41-8-4)21-31(33)35(46-34)37(43-17-10-6-2)38(36)44-18-11-7-3/h12-15,21-22,28-29,34-38H,5-11,16-20,23-25H2,1-4H3/t28-,29+,34-,35+,36-,37+,38+/m1/s1 |
| InChIKey | JRLFKHGKRZUIKW-NFMSTIKSSA-N |
| XLogP | 8.37 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.30 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|