C36H37ClO5 — CID 90086875
[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl benzoate (PubChem CID 90086875) has the molecular formula C36H37ClO5 and a molecular weight of 585.14 g/mol. Its IUPAC name is [2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl benzoate.
| Compound Name | [2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl benzoate |
|---|---|
| PubChem CID | 90086875 |
| Molecular Formula | C36H37ClO5 |
| Molecular Weight | 585.14 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | [2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl benzoate |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(COC(=O)c3ccccc3)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C36H37ClO5/c1-3-32-25(2)33(39-22-26-13-7-4-8-14-26)35(40-23-27-15-9-5-10-16-27)34(42-32)29-19-20-31(37)30(21-29)24-41-36(38)28-17-11-6-12-18-28/h4-21,25,32-35H,3,22-24H2,1-2H3/t25-,32-,33+,34+,35?/m1/s1 |
| InChIKey | OOISOBUNRLXWFA-QXTBNCIQSA-N |
| XLogP | 8.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.14 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |