C35H35ClO5 — CID 58242570
2-chloro-5-[(2S,3S,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]benzaldehyde (PubChem CID 58242570) has the molecular formula C35H35ClO5 and a molecular weight of 571.11 g/mol. Its IUPAC name is 2-chloro-5-[(2S,3S,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]benzaldehyde.
| Compound Name | 2-chloro-5-[(2S,3S,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 58242570 |
| Molecular Formula | C35H35ClO5 |
| Molecular Weight | 571.11 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 2-chloro-5-[(2S,3S,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]benzaldehyde |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(C=O)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H35ClO5/c1-2-31-33(38-22-25-12-6-3-7-13-25)35(40-24-27-16-10-5-11-17-27)34(39-23-26-14-8-4-9-15-26)32(41-31)28-18-19-30(36)29(20-28)21-37/h3-21,31-35H,2,22-24H2,1H3/t31-,32+,33-,34?,35+/m1/s1 |
| InChIKey | ZJBRFAXOPJFVSS-VHMVDCLJSA-N |
| XLogP | 7.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.11 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|