C25H30O7S — CID 66562209
(2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-methylsulfonyloxane-3,4,5-triol (PubChem CID 66562209) has the molecular formula C25H30O7S and a molecular weight of 474.58 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-methylsulfonyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-methylsulfonyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 66562209 |
| Molecular Formula | C25H30O7S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-methylsulfonyloxane-3,4,5-triol |
| SMILES | CS(=O)(=O)[C@H]1O[C@@H](c2ccc(C3CC3)c(Cc3ccc4c(c3)CCCO4)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H30O7S/c1-33(29,30)25-23(28)21(26)22(27)24(32-25)17-7-8-19(15-5-6-15)18(13-17)12-14-4-9-20-16(11-14)3-2-10-31-20/h4,7-9,11,13,15,21-28H,2-3,5-6,10,12H2,1H3/t21-,22-,23+,24+,25-/m1/s1 |
| InChIKey | DMIYYZYNHGNGOF-WJGLBBAVSA-N |
| XLogP | 2.00 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |