C24H29NO8S2 — CID 66562925
(2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[(1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-7-yl)methyl]phenyl]-6-methylsulfonyloxane-3,4,5-triol (PubChem CID 66562925) has the molecular formula C24H29NO8S2 and a molecular weight of 523.63 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[(1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-7-yl)methyl]phenyl]-6-methylsulfonyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[(1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-7-yl)methyl]phenyl]-6-methylsulfonyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 66562925 |
| Molecular Formula | C24H29NO8S2 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-cyclopropyl-3-[(1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-7-yl)methyl]phenyl]-6-methylsulfonyloxane-3,4,5-triol |
| SMILES | CS(=O)(=O)[C@H]1O[C@@H](c2ccc(C3CC3)c(Cc3ccc4c(c3)S(=O)(=O)CCN4)c2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29NO8S2/c1-34(29,30)24-22(28)20(26)21(27)23(33-24)15-5-6-17(14-3-4-14)16(12-15)10-13-2-7-18-19(11-13)35(31,32)9-8-25-18/h2,5-7,11-12,14,20-28H,3-4,8-10H2,1H3/t20-,21?,22+,23+,24-/m1/s1 |
| InChIKey | BZKIAEVAFMWJSV-QCWNEBDDSA-N |
| XLogP | 0.88 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |