C27H37BO11 — CID 123422675
[3,4,5-triacetyloxy-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxan-2-yl]methyl acetate (PubChem CID 123422675) has the molecular formula C27H37BO11 and a molecular weight of 548.39 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123422675 |
| Molecular Formula | C27H37BO11 |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C27H37BO11/c1-15(29)33-14-22-24(35-17(3)31)25(36-18(4)32)23(34-16(2)30)21(37-22)13-19-9-11-20(12-10-19)28-38-26(5,6)27(7,8)39-28/h9-12,21-25H,13-14H2,1-8H3 |
| InChIKey | OADKZFHJDUPQTN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|