C23H33BN2O11 — CID 175229576
[(2R,3R,4S,5R,6S)-3,5,6-triacetyloxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 175229576) has the molecular formula C23H33BN2O11 and a molecular weight of 524.33 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5,6-triacetyloxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5,6-triacetyloxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175229576 |
| Molecular Formula | C23H33BN2O11 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5,6-triacetyloxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](n2cc(B3OC(C)(C)C(C)(C)O3)cn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H33BN2O11/c1-12(27)31-11-17-19(32-13(2)28)18(20(33-14(3)29)21(35-17)34-15(4)30)26-10-16(9-25-26)24-36-22(5,6)23(7,8)37-24/h9-10,17-21H,11H2,1-8H3/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | ZQFYEXYDLLPTTP-XDWAVFMPSA-N |
| XLogP | 0.44 |
| TPSA | 150.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|