C24H33BClN3O5S — CID 167547952
[(3R,4S,6R)-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 167547952) has the molecular formula C24H33BClN3O5S and a molecular weight of 521.88 g/mol. Its IUPAC name is [(3R,4S,6R)-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167547952 |
| Molecular Formula | C24H33BClN3O5S |
| Molecular Weight | 521.88 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | [(3R,4S,6R)-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cncc(Cl)c2)C(C)[C@@H](n2cc(B3OC(C)(C)C(C)(C)O3)cn2)[C@H]1C |
| InChI | InChI=1S/C24H33BClN3O5S/c1-14-20(13-31-16(3)30)32-22(35-19-8-18(26)10-27-11-19)15(2)21(14)29-12-17(9-28-29)25-33-23(4,5)24(6,7)34-25/h8-12,14-15,20-22H,13H2,1-7H3/t14-,15?,20?,21-,22+/m0/s1 |
| InChIKey | CAQPHXFTYVOGDM-WYEBBVGMSA-N |
| XLogP | 4.12 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|